About 3-amino-5H-1,5-benzothiazepin-4-one
3-amino-5H-1,5-benzothiazepin-4-one (PubChem CID 70506908) has the molecular formula C9H8N2OS
and a molecular weight of 192.24 g/mol. Its IUPAC name is 3-amino-5H-1,5-benzothiazepin-4-one.
Molecular Properties
| Compound Name | 3-amino-5H-1,5-benzothiazepin-4-one |
| PubChem CID | 70506908 |
| Molecular Formula | C9H8N2OS |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 3-amino-5H-1,5-benzothiazepin-4-one |
| SMILES | NC1=CSc2ccccc2NC1=O |
| InChI | InChI=1S/C9H8N2OS/c10-6-5-13-8-4-2-1-3-7(8)11-9(6)12/h1-5H,10H2,(H,11,12) |
| InChIKey | RMIUGVCXZWWKEB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-5H-1,5-benzothiazepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5H-1,5-benzothiazepin-4-one?
The IUPAC name of 3-amino-5H-1,5-benzothiazepin-4-one (CID 70506908) is 3-amino-5H-1,5-benzothiazepin-4-one.
What is the SMILES notation for 3-amino-5H-1,5-benzothiazepin-4-one?
The canonical SMILES for 3-amino-5H-1,5-benzothiazepin-4-one is NC1=CSc2ccccc2NC1=O.
What is the InChIKey of 3-amino-5H-1,5-benzothiazepin-4-one?
The InChIKey is RMIUGVCXZWWKEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2OS/c10-6-5-13-8-4-2-1-3-7(8)11-9(6)12/h1-5H,10H2,(H,11,12).
What are the key properties of 3-amino-5H-1,5-benzothiazepin-4-one?
3-amino-5H-1,5-benzothiazepin-4-one has a molecular weight of 192.24 g/mol, XLogP of 1.53, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5H-1,5-benzothiazepin-4-one is sourced from PubChem (CID 70506908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).