C11H9NO5S — CID 160948654
5H-1,5-benzothiazepin-4-one;oxalic acid (PubChem CID 160948654) has the molecular formula C11H9NO5S and a molecular weight of 267.26 g/mol. Its IUPAC name is 5H-1,5-benzothiazepin-4-one;oxalic acid.
| Compound Name | 5H-1,5-benzothiazepin-4-one;oxalic acid |
|---|---|
| PubChem CID | 160948654 |
| Molecular Formula | C11H9NO5S |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | 5H-1,5-benzothiazepin-4-one;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=C1C=CSc2ccccc2N1 |
| InChI | InChI=1S/C9H7NOS.C2H2O4/c11-9-5-6-12-8-4-2-1-3-7(8)10-9;3-1(4)2(5)6/h1-6H,(H,10,11);(H,3,4)(H,5,6) |
| InChIKey | SVLOYCDHGOCWFP-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|