About 1,4-dihydroquinoline;hydrochloride
1,4-dihydroquinoline;hydrochloride (PubChem CID 70537011) has the molecular formula C9H10ClN
and a molecular weight of 167.64 g/mol. Its IUPAC name is 1,4-dihydroquinoline;hydrochloride.
Molecular Properties
| Compound Name | 1,4-dihydroquinoline;hydrochloride |
| PubChem CID | 70537011 |
| Molecular Formula | C9H10ClN |
| Molecular Weight | 167.64 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | 1,4-dihydroquinoline;hydrochloride |
| SMILES | C1=CNc2ccccc2C1.Cl |
| InChI | InChI=1S/C9H9N.ClH/c1-2-6-9-8(4-1)5-3-7-10-9;/h1-4,6-7,10H,5H2;1H |
| InChIKey | XVILWXWQFHRDNT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.64 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,4-dihydroquinoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dihydroquinoline;hydrochloride?
The IUPAC name of 1,4-dihydroquinoline;hydrochloride (CID 70537011) is 1,4-dihydroquinoline;hydrochloride.
What is the SMILES notation for 1,4-dihydroquinoline;hydrochloride?
The canonical SMILES for 1,4-dihydroquinoline;hydrochloride is C1=CNc2ccccc2C1.Cl.
What is the InChIKey of 1,4-dihydroquinoline;hydrochloride?
The InChIKey is XVILWXWQFHRDNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N.ClH/c1-2-6-9-8(4-1)5-3-7-10-9;/h1-4,6-7,10H,5H2;1H.
What are the key properties of 1,4-dihydroquinoline;hydrochloride?
1,4-dihydroquinoline;hydrochloride has a molecular weight of 167.64 g/mol, XLogP of 2.59, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dihydroquinoline;hydrochloride is sourced from PubChem (CID 70537011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).