C9H10ClN — CID 70537011
1,4-dihydroquinoline;hydrochloride (PubChem CID 70537011) has the molecular formula C9H10ClN and a molecular weight of 167.64 g/mol. Its IUPAC name is 1,4-dihydroquinoline;hydrochloride.
| Compound Name | 1,4-dihydroquinoline;hydrochloride |
|---|---|
| PubChem CID | 70537011 |
| Molecular Formula | C9H10ClN |
| Molecular Weight | 167.64 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | 1,4-dihydroquinoline;hydrochloride |
| SMILES | C1=CNc2ccccc2C1.Cl |
| InChI | InChI=1S/C9H9N.ClH/c1-2-6-9-8(4-1)5-3-7-10-9;/h1-4,6-7,10H,5H2;1H |
| InChIKey | XVILWXWQFHRDNT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.64 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |