About azane;4-chloro-1-methylpiperidine;hydrate
azane;4-chloro-1-methylpiperidine;hydrate (PubChem CID 174420650) has the molecular formula C6H17ClN2O
and a molecular weight of 168.67 g/mol. Its IUPAC name is azane;4-chloro-1-methylpiperidine;hydrate.
Molecular Properties
| Compound Name | azane;4-chloro-1-methylpiperidine;hydrate |
| PubChem CID | 174420650 |
| Molecular Formula | C6H17ClN2O |
| Molecular Weight | 168.67 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | azane;4-chloro-1-methylpiperidine;hydrate |
| SMILES | CN1CCC(Cl)CC1.N.O |
| InChI | InChI=1S/C6H12ClN.H3N.H2O/c1-8-4-2-6(7)3-5-8;;/h6H,2-5H2,1H3;1H3;1H2 |
| InChIKey | BBGVFWROUVPNKF-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 69.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.67 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze azane;4-chloro-1-methylpiperidine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;4-chloro-1-methylpiperidine;hydrate?
The IUPAC name of azane;4-chloro-1-methylpiperidine;hydrate (CID 174420650) is azane;4-chloro-1-methylpiperidine;hydrate.
What is the SMILES notation for azane;4-chloro-1-methylpiperidine;hydrate?
The canonical SMILES for azane;4-chloro-1-methylpiperidine;hydrate is CN1CCC(Cl)CC1.N.O.
What is the InChIKey of azane;4-chloro-1-methylpiperidine;hydrate?
The InChIKey is BBGVFWROUVPNKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12ClN.H3N.H2O/c1-8-4-2-6(7)3-5-8;;/h6H,2-5H2,1H3;1H3;1H2.
What are the key properties of azane;4-chloro-1-methylpiperidine;hydrate?
azane;4-chloro-1-methylpiperidine;hydrate has a molecular weight of 168.67 g/mol, XLogP of 0.66, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;4-chloro-1-methylpiperidine;hydrate is sourced from PubChem (CID 174420650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).