C16H18BrNO2S — CID 174424491
4-(4-bromophenyl)-3-tert-butylbenzenesulfonamide (PubChem CID 174424491) has the molecular formula C16H18BrNO2S and a molecular weight of 368.30 g/mol. Its IUPAC name is 4-(4-bromophenyl)-3-tert-butylbenzenesulfonamide.
| Compound Name | 4-(4-bromophenyl)-3-tert-butylbenzenesulfonamide |
|---|---|
| PubChem CID | 174424491 |
| Molecular Formula | C16H18BrNO2S |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 4-(4-bromophenyl)-3-tert-butylbenzenesulfonamide |
| SMILES | CC(C)(C)c1cc(S(N)(=O)=O)ccc1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H18BrNO2S/c1-16(2,3)15-10-13(21(18,19)20)8-9-14(15)11-4-6-12(17)7-5-11/h4-10H,1-3H3,(H2,18,19,20) |
| InChIKey | LOPWRYCVHFOJEY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.30 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |