About sodium;hydride;nitroso hydrogen sulfate
sodium;hydride;nitroso hydrogen sulfate (PubChem CID 174425438) has the molecular formula H2NNaO5S
and a molecular weight of 151.07 g/mol. Its IUPAC name is sodium;hydride;nitroso hydrogen sulfate.
Molecular Properties
| Compound Name | sodium;hydride;nitroso hydrogen sulfate |
| PubChem CID | 174425438 |
| Molecular Formula | H2NNaO5S |
| Molecular Weight | 151.07 g/mol |
| Exact Mass | 150.96 |
| IUPAC Name | sodium;hydride;nitroso hydrogen sulfate |
| SMILES | O=NOS(=O)(=O)O.[H-].[Na+] |
| InChI | InChI=1S/HNO5S.Na.H/c2-1-6-7(3,4)5;;/h(H,3,4,5);;/q;+1;-1 |
| InChIKey | GZFSMKALSGPCRZ-UHFFFAOYSA-N |
| XLogP | -3.40 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.07 |
| LogP ≤ 5 | -3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;nitroso hydrogen sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;nitroso hydrogen sulfate?
The IUPAC name of sodium;hydride;nitroso hydrogen sulfate (CID 174425438) is sodium;hydride;nitroso hydrogen sulfate.
What is the SMILES notation for sodium;hydride;nitroso hydrogen sulfate?
The canonical SMILES for sodium;hydride;nitroso hydrogen sulfate is O=NOS(=O)(=O)O.[H-].[Na+].
What is the InChIKey of sodium;hydride;nitroso hydrogen sulfate?
The InChIKey is GZFSMKALSGPCRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/HNO5S.Na.H/c2-1-6-7(3,4)5;;/h(H,3,4,5);;/q;+1;-1.
What are the key properties of sodium;hydride;nitroso hydrogen sulfate?
sodium;hydride;nitroso hydrogen sulfate has a molecular weight of 151.07 g/mol, XLogP of -3.40, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;nitroso hydrogen sulfate is sourced from PubChem (CID 174425438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).