nitroso hydrogen sulfate;nitrous acid

H2N2O7S — CID 159941203

IUPACnitroso hydrogen sulfate;nitrous acid
SMILESO=NO.O=NOS(=O)(=O)O
InChIInChI=1S/HNO5S.HNO2/c2-1-6-7(3,4)5;2-1-3/h(H,3,4,5);(H,2,3)
InChIKeyOAXFHRCGUKWOSQ-UHFFFAOYSA-N
MW174.09 g/mol
LogP-0.37
Rot. Bonds2

About nitroso hydrogen sulfate;nitrous acid

nitroso hydrogen sulfate;nitrous acid (PubChem CID 159941203) has the molecular formula H2N2O7S and a molecular weight of 174.09 g/mol. Its IUPAC name is nitroso hydrogen sulfate;nitrous acid.

Molecular Properties

Compound Namenitroso hydrogen sulfate;nitrous acid
PubChem CID159941203
Molecular FormulaH2N2O7S
Molecular Weight174.09 g/mol
Exact Mass173.96
IUPAC Namenitroso hydrogen sulfate;nitrous acid
SMILESO=NO.O=NOS(=O)(=O)O
InChIInChI=1S/HNO5S.HNO2/c2-1-6-7(3,4)5;2-1-3/h(H,3,4,5);(H,2,3)
InChIKeyOAXFHRCGUKWOSQ-UHFFFAOYSA-N
XLogP-0.37
TPSA142.69 Ų
H-Bond Donors2
H-Bond Acceptors7
Rotatable Bonds2
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500174.09
LogP ≤ 5-0.37
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze nitroso hydrogen sulfate;nitrous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

sodium;hydride;nitroso hydrogen sulfate
CID 174425438
nitroso sulfooxy sulfate
CID 175147851
azane;nitrous acid;sulfuric acid
CID 161480385
nitrous acid;silver;sulfuric acid
CID 173365762
sodium;hydrogen sulfate;nitrous acid
CID 173241300
CID 173332753
CID 173332753
silane;sulfo hydrogen sulfate
CID 173332743
CID 20507039
CID 20507039
imino(sulfooxyimino)azanium
CID 173131438
lithium;hydride;nitrous acid;silane
CID 173072807
nickel;nitrous acid
CID 173223682
CID 156592461
CID 156592461

Frequently Asked Questions

What is the IUPAC name of nitroso hydrogen sulfate;nitrous acid?
The IUPAC name of nitroso hydrogen sulfate;nitrous acid (CID 159941203) is nitroso hydrogen sulfate;nitrous acid.
What is the SMILES notation for nitroso hydrogen sulfate;nitrous acid?
The canonical SMILES for nitroso hydrogen sulfate;nitrous acid is O=NO.O=NOS(=O)(=O)O.
What is the InChIKey of nitroso hydrogen sulfate;nitrous acid?
The InChIKey is OAXFHRCGUKWOSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/HNO5S.HNO2/c2-1-6-7(3,4)5;2-1-3/h(H,3,4,5);(H,2,3).
What are the key properties of nitroso hydrogen sulfate;nitrous acid?
nitroso hydrogen sulfate;nitrous acid has a molecular weight of 174.09 g/mol, XLogP of -0.37, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for nitroso hydrogen sulfate;nitrous acid is sourced from PubChem (CID 159941203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).