About 2-thiophen-2-yloxyphenol;zirconium(2+);dichloride
2-thiophen-2-yloxyphenol;zirconium(2+);dichloride (PubChem CID 174428379) has the molecular formula C10H8Cl2O2SZr
and a molecular weight of 354.37 g/mol. Its IUPAC name is 2-thiophen-2-yloxyphenol;zirconium(2+);dichloride.
Molecular Properties
| Compound Name | 2-thiophen-2-yloxyphenol;zirconium(2+);dichloride |
| PubChem CID | 174428379 |
| Molecular Formula | C10H8Cl2O2SZr |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 351.87 |
| IUPAC Name | 2-thiophen-2-yloxyphenol;zirconium(2+);dichloride |
| SMILES | Oc1ccccc1Oc1cccs1.[Cl-].[Cl-].[Zr+2] |
| InChI | InChI=1S/C10H8O2S.2ClH.Zr/c11-8-4-1-2-5-9(8)12-10-6-3-7-13-10;;;/h1-7,11H;2*1H;/q;;;+2/p-2 |
| InChIKey | HNPOFNDFPBZVOT-UHFFFAOYSA-L |
| XLogP | -2.75 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-thiophen-2-yloxyphenol;zirconium(2+);dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thiophen-2-yloxyphenol;zirconium(2+);dichloride?
The IUPAC name of 2-thiophen-2-yloxyphenol;zirconium(2+);dichloride (CID 174428379) is 2-thiophen-2-yloxyphenol;zirconium(2+);dichloride.
What is the SMILES notation for 2-thiophen-2-yloxyphenol;zirconium(2+);dichloride?
The canonical SMILES for 2-thiophen-2-yloxyphenol;zirconium(2+);dichloride is Oc1ccccc1Oc1cccs1.[Cl-].[Cl-].[Zr+2].
What is the InChIKey of 2-thiophen-2-yloxyphenol;zirconium(2+);dichloride?
The InChIKey is HNPOFNDFPBZVOT-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H8O2S.2ClH.Zr/c11-8-4-1-2-5-9(8)12-10-6-3-7-13-10;;;/h1-7,11H;2*1H;/q;;;+2/p-2.
What are the key properties of 2-thiophen-2-yloxyphenol;zirconium(2+);dichloride?
2-thiophen-2-yloxyphenol;zirconium(2+);dichloride has a molecular weight of 354.37 g/mol, XLogP of -2.75, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thiophen-2-yloxyphenol;zirconium(2+);dichloride is sourced from PubChem (CID 174428379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).