About 3-thiophen-2-yloxyphenol
3-thiophen-2-yloxyphenol (PubChem CID 87844697) has the molecular formula C10H8O2S
and a molecular weight of 192.24 g/mol. Its IUPAC name is 3-thiophen-2-yloxyphenol.
Molecular Properties
| Compound Name | 3-thiophen-2-yloxyphenol |
| PubChem CID | 87844697 |
| Molecular Formula | C10H8O2S |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | 3-thiophen-2-yloxyphenol |
| SMILES | Oc1cccc(Oc2cccs2)c1 |
| InChI | InChI=1S/C10H8O2S/c11-8-3-1-4-9(7-8)12-10-5-2-6-13-10/h1-7,11H |
| InChIKey | MCMGOCAQBQRSEG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-thiophen-2-yloxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-thiophen-2-yloxyphenol?
The IUPAC name of 3-thiophen-2-yloxyphenol (CID 87844697) is 3-thiophen-2-yloxyphenol.
What is the SMILES notation for 3-thiophen-2-yloxyphenol?
The canonical SMILES for 3-thiophen-2-yloxyphenol is Oc1cccc(Oc2cccs2)c1.
What is the InChIKey of 3-thiophen-2-yloxyphenol?
The InChIKey is MCMGOCAQBQRSEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O2S/c11-8-3-1-4-9(7-8)12-10-5-2-6-13-10/h1-7,11H.
What are the key properties of 3-thiophen-2-yloxyphenol?
3-thiophen-2-yloxyphenol has a molecular weight of 192.24 g/mol, XLogP of 3.25, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-thiophen-2-yloxyphenol is sourced from PubChem (CID 87844697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).