About 3-phenylperoxyphenol
3-phenylperoxyphenol (PubChem CID 87446766) has the molecular formula C12H10O3
and a molecular weight of 202.21 g/mol. Its IUPAC name is 3-phenylperoxyphenol.
Molecular Properties
| Compound Name | 3-phenylperoxyphenol |
| PubChem CID | 87446766 |
| Molecular Formula | C12H10O3 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 3-phenylperoxyphenol |
| SMILES | Oc1cccc(OOc2ccccc2)c1 |
| InChI | InChI=1S/C12H10O3/c13-10-5-4-8-12(9-10)15-14-11-6-2-1-3-7-11/h1-9,13H |
| InChIKey | OGGVLDMGJPLCML-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylperoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylperoxyphenol?
The IUPAC name of 3-phenylperoxyphenol (CID 87446766) is 3-phenylperoxyphenol.
What is the SMILES notation for 3-phenylperoxyphenol?
The canonical SMILES for 3-phenylperoxyphenol is Oc1cccc(OOc2ccccc2)c1.
What is the InChIKey of 3-phenylperoxyphenol?
The InChIKey is OGGVLDMGJPLCML-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O3/c13-10-5-4-8-12(9-10)15-14-11-6-2-1-3-7-11/h1-9,13H.
What are the key properties of 3-phenylperoxyphenol?
3-phenylperoxyphenol has a molecular weight of 202.21 g/mol, XLogP of 2.77, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylperoxyphenol is sourced from PubChem (CID 87446766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).