About potassium;hydride;phenylperoxybenzene
potassium;hydride;phenylperoxybenzene (PubChem CID 174274599) has the molecular formula C12H11KO2
and a molecular weight of 226.32 g/mol. Its IUPAC name is potassium;hydride;phenylperoxybenzene.
Molecular Properties
| Compound Name | potassium;hydride;phenylperoxybenzene |
| PubChem CID | 174274599 |
| Molecular Formula | C12H11KO2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | potassium;hydride;phenylperoxybenzene |
| SMILES | [H-].[K+].c1ccc(OOc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10O2.K.H/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;;/h1-10H;;/q;+1;-1 |
| InChIKey | HDKGXFUNFKRYAY-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze potassium;hydride;phenylperoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;phenylperoxybenzene?
The IUPAC name of potassium;hydride;phenylperoxybenzene (CID 174274599) is potassium;hydride;phenylperoxybenzene.
What is the SMILES notation for potassium;hydride;phenylperoxybenzene?
The canonical SMILES for potassium;hydride;phenylperoxybenzene is [H-].[K+].c1ccc(OOc2ccccc2)cc1.
What is the InChIKey of potassium;hydride;phenylperoxybenzene?
The InChIKey is HDKGXFUNFKRYAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O2.K.H/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;;/h1-10H;;/q;+1;-1.
What are the key properties of potassium;hydride;phenylperoxybenzene?
potassium;hydride;phenylperoxybenzene has a molecular weight of 226.32 g/mol, XLogP of 0.18, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;phenylperoxybenzene is sourced from PubChem (CID 174274599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).