About azane;phenylperoxybenzene
azane;phenylperoxybenzene (PubChem CID 174490395) has the molecular formula C12H13NO2
and a molecular weight of 203.24 g/mol. Its IUPAC name is azane;phenylperoxybenzene.
Molecular Properties
| Compound Name | azane;phenylperoxybenzene |
| PubChem CID | 174490395 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | azane;phenylperoxybenzene |
| SMILES | N.c1ccc(OOc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10O2.H3N/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;/h1-10H;1H3 |
| InChIKey | LCJMEMSFLPUUCI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 53.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze azane;phenylperoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;phenylperoxybenzene?
The IUPAC name of azane;phenylperoxybenzene (CID 174490395) is azane;phenylperoxybenzene.
What is the SMILES notation for azane;phenylperoxybenzene?
The canonical SMILES for azane;phenylperoxybenzene is N.c1ccc(OOc2ccccc2)cc1.
What is the InChIKey of azane;phenylperoxybenzene?
The InChIKey is LCJMEMSFLPUUCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O2.H3N/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;/h1-10H;1H3.
What are the key properties of azane;phenylperoxybenzene?
azane;phenylperoxybenzene has a molecular weight of 203.24 g/mol, XLogP of 3.22, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;phenylperoxybenzene is sourced from PubChem (CID 174490395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).