About sodium phenylperoxybenzene
sodium phenylperoxybenzene (PubChem CID 174640898) has the molecular formula C12H9NaO2
and a molecular weight of 208.19 g/mol. Its IUPAC name is sodium phenylperoxybenzene.
Molecular Properties
| Compound Name | sodium phenylperoxybenzene |
| PubChem CID | 174640898 |
| Molecular Formula | C12H9NaO2 |
| Molecular Weight | 208.19 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | sodium phenylperoxybenzene |
| SMILES | [Na+].[c-]1ccccc1OOc1ccccc1 |
| InChI | InChI=1S/C12H9O2.Na/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;/h1-9H;/q-1;+1 |
| InChIKey | IYEARIBEEHODPV-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.19 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze sodium phenylperoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium phenylperoxybenzene?
The IUPAC name of sodium phenylperoxybenzene (CID 174640898) is sodium phenylperoxybenzene.
What is the SMILES notation for sodium phenylperoxybenzene?
The canonical SMILES for sodium phenylperoxybenzene is [Na+].[c-]1ccccc1OOc1ccccc1.
What is the InChIKey of sodium phenylperoxybenzene?
The InChIKey is IYEARIBEEHODPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9O2.Na/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;/h1-9H;/q-1;+1.
What are the key properties of sodium phenylperoxybenzene?
sodium phenylperoxybenzene has a molecular weight of 208.19 g/mol, XLogP of -0.14, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium phenylperoxybenzene is sourced from PubChem (CID 174640898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).