C10H16N2O — CID 174429069
methane;3-(oxiran-2-ylmethyl)benzene-1,2-diamine (PubChem CID 174429069) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is methane;3-(oxiran-2-ylmethyl)benzene-1,2-diamine.
| Compound Name | methane;3-(oxiran-2-ylmethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 174429069 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | methane;3-(oxiran-2-ylmethyl)benzene-1,2-diamine |
| SMILES | C.Nc1cccc(CC2CO2)c1N |
| InChI | InChI=1S/C9H12N2O.CH4/c10-8-3-1-2-6(9(8)11)4-7-5-12-7;/h1-3,7H,4-5,10-11H2;1H4 |
| InChIKey | HVCIKFFAUZWSQU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 64.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|