C18H21ClO4S — CID 174431102
1-[5-(4-chlorophenyl)-2-methylsulfonylphenoxy]-3-methylbutan-2-ol (PubChem CID 174431102) has the molecular formula C18H21ClO4S and a molecular weight of 368.88 g/mol. Its IUPAC name is 1-[5-(4-chlorophenyl)-2-methylsulfonylphenoxy]-3-methylbutan-2-ol.
| Compound Name | 1-[5-(4-chlorophenyl)-2-methylsulfonylphenoxy]-3-methylbutan-2-ol |
|---|---|
| PubChem CID | 174431102 |
| Molecular Formula | C18H21ClO4S |
| Molecular Weight | 368.88 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 1-[5-(4-chlorophenyl)-2-methylsulfonylphenoxy]-3-methylbutan-2-ol |
| SMILES | CC(C)C(O)COc1cc(-c2ccc(Cl)cc2)ccc1S(C)(=O)=O |
| InChI | InChI=1S/C18H21ClO4S/c1-12(2)16(20)11-23-17-10-14(6-9-18(17)24(3,21)22)13-4-7-15(19)8-5-13/h4-10,12,16,20H,11H2,1-3H3 |
| InChIKey | ZEUJYVNPWNBUEA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.88 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |