C13H13NO9 — CID 174432085
2-[2-(dicarboxymethyl)-5-(methoxymethyl)-3-pyridinyl]propanedioic acid (PubChem CID 174432085) has the molecular formula C13H13NO9 and a molecular weight of 327.25 g/mol. Its IUPAC name is 2-[2-(dicarboxymethyl)-5-(methoxymethyl)-3-pyridinyl]propanedioic acid.
| Compound Name | 2-[2-(dicarboxymethyl)-5-(methoxymethyl)-3-pyridinyl]propanedioic acid |
|---|---|
| PubChem CID | 174432085 |
| Molecular Formula | C13H13NO9 |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 2-[2-(dicarboxymethyl)-5-(methoxymethyl)-3-pyridinyl]propanedioic acid |
| SMILES | COCc1cnc(C(C(=O)O)C(=O)O)c(C(C(=O)O)C(=O)O)c1 |
| InChI | InChI=1S/C13H13NO9/c1-23-4-5-2-6(7(10(15)16)11(17)18)9(14-3-5)8(12(19)20)13(21)22/h2-3,7-8H,4H2,1H3,(H,15,16)(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | GNUYSWHZFYVECF-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 171.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|