About 1-(4-fluorophenyl)ethyl 5-amino-4-oxopentanoate;hydrochloride
1-(4-fluorophenyl)ethyl 5-amino-4-oxopentanoate;hydrochloride (PubChem CID 174434660) has the molecular formula C13H17ClFNO3
and a molecular weight of 289.73 g/mol. Its IUPAC name is 1-(4-fluorophenyl)ethyl 5-amino-4-oxopentanoate;hydrochloride.
Molecular Properties
| Compound Name | 1-(4-fluorophenyl)ethyl 5-amino-4-oxopentanoate;hydrochloride |
| PubChem CID | 174434660 |
| Molecular Formula | C13H17ClFNO3 |
| Molecular Weight | 289.73 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 1-(4-fluorophenyl)ethyl 5-amino-4-oxopentanoate;hydrochloride |
| SMILES | CC(OC(=O)CCC(=O)CN)c1ccc(F)cc1.Cl |
| InChI | InChI=1S/C13H16FNO3.ClH/c1-9(10-2-4-11(14)5-3-10)18-13(17)7-6-12(16)8-15;/h2-5,9H,6-8,15H2,1H3;1H |
| InChIKey | FBDUEXHLAAXFEA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.73 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-fluorophenyl)ethyl 5-amino-4-oxopentanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluorophenyl)ethyl 5-amino-4-oxopentanoate;hydrochloride?
The IUPAC name of 1-(4-fluorophenyl)ethyl 5-amino-4-oxopentanoate;hydrochloride (CID 174434660) is 1-(4-fluorophenyl)ethyl 5-amino-4-oxopentanoate;hydrochloride.
What is the SMILES notation for 1-(4-fluorophenyl)ethyl 5-amino-4-oxopentanoate;hydrochloride?
The canonical SMILES for 1-(4-fluorophenyl)ethyl 5-amino-4-oxopentanoate;hydrochloride is CC(OC(=O)CCC(=O)CN)c1ccc(F)cc1.Cl.
What is the InChIKey of 1-(4-fluorophenyl)ethyl 5-amino-4-oxopentanoate;hydrochloride?
The InChIKey is FBDUEXHLAAXFEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16FNO3.ClH/c1-9(10-2-4-11(14)5-3-10)18-13(17)7-6-12(16)8-15;/h2-5,9H,6-8,15H2,1H3;1H.
What are the key properties of 1-(4-fluorophenyl)ethyl 5-amino-4-oxopentanoate;hydrochloride?
1-(4-fluorophenyl)ethyl 5-amino-4-oxopentanoate;hydrochloride has a molecular weight of 289.73 g/mol, XLogP of 2.16, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluorophenyl)ethyl 5-amino-4-oxopentanoate;hydrochloride is sourced from PubChem (CID 174434660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).