C13H20ClN3O2S — CID 174435712
[4-[5-(chloromethyl)-1,3-thiazol-2-yl]piperazin-1-yl] 2,2-dimethylpropanoate (PubChem CID 174435712) has the molecular formula C13H20ClN3O2S and a molecular weight of 317.84 g/mol. Its IUPAC name is [4-[5-(chloromethyl)-1,3-thiazol-2-yl]piperazin-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [4-[5-(chloromethyl)-1,3-thiazol-2-yl]piperazin-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174435712 |
| Molecular Formula | C13H20ClN3O2S |
| Molecular Weight | 317.84 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | [4-[5-(chloromethyl)-1,3-thiazol-2-yl]piperazin-1-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)ON1CCN(c2ncc(CCl)s2)CC1 |
| InChI | InChI=1S/C13H20ClN3O2S/c1-13(2,3)11(18)19-17-6-4-16(5-7-17)12-15-9-10(8-14)20-12/h9H,4-8H2,1-3H3 |
| InChIKey | FHFZZLBCZJWISG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.84 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|