About 2-[1-(diethylamino)ethylphosphanyl]ethane-1,1,2-triol
2-[1-(diethylamino)ethylphosphanyl]ethane-1,1,2-triol (PubChem CID 174435881) has the molecular formula C8H20NO3P
and a molecular weight of 209.23 g/mol. Its IUPAC name is 2-[1-(diethylamino)ethylphosphanyl]ethane-1,1,2-triol.
Molecular Properties
| Compound Name | 2-[1-(diethylamino)ethylphosphanyl]ethane-1,1,2-triol |
| PubChem CID | 174435881 |
| Molecular Formula | C8H20NO3P |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 2-[1-(diethylamino)ethylphosphanyl]ethane-1,1,2-triol |
| SMILES | CCN(CC)C(C)PC(O)C(O)O |
| InChI | InChI=1S/C8H20NO3P/c1-4-9(5-2)6(3)13-8(12)7(10)11/h6-8,10-13H,4-5H2,1-3H3 |
| InChIKey | ZZIPFVDLCRVEIZ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-(diethylamino)ethylphosphanyl]ethane-1,1,2-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(diethylamino)ethylphosphanyl]ethane-1,1,2-triol?
The IUPAC name of 2-[1-(diethylamino)ethylphosphanyl]ethane-1,1,2-triol (CID 174435881) is 2-[1-(diethylamino)ethylphosphanyl]ethane-1,1,2-triol.
What is the SMILES notation for 2-[1-(diethylamino)ethylphosphanyl]ethane-1,1,2-triol?
The canonical SMILES for 2-[1-(diethylamino)ethylphosphanyl]ethane-1,1,2-triol is CCN(CC)C(C)PC(O)C(O)O.
What is the InChIKey of 2-[1-(diethylamino)ethylphosphanyl]ethane-1,1,2-triol?
The InChIKey is ZZIPFVDLCRVEIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20NO3P/c1-4-9(5-2)6(3)13-8(12)7(10)11/h6-8,10-13H,4-5H2,1-3H3.
What are the key properties of 2-[1-(diethylamino)ethylphosphanyl]ethane-1,1,2-triol?
2-[1-(diethylamino)ethylphosphanyl]ethane-1,1,2-triol has a molecular weight of 209.23 g/mol, XLogP of -0.02, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(diethylamino)ethylphosphanyl]ethane-1,1,2-triol is sourced from PubChem (CID 174435881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).