C13H29NO2 — CID 71373825
2-(diethylamino)-7-methyloctane-3,4-diol (PubChem CID 71373825) has the molecular formula C13H29NO2 and a molecular weight of 231.38 g/mol. Its IUPAC name is 2-(diethylamino)-7-methyloctane-3,4-diol.
| Compound Name | 2-(diethylamino)-7-methyloctane-3,4-diol |
|---|---|
| PubChem CID | 71373825 |
| Molecular Formula | C13H29NO2 |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.22 |
| IUPAC Name | 2-(diethylamino)-7-methyloctane-3,4-diol |
| SMILES | CCN(CC)C(C)C(O)C(O)CCC(C)C |
| InChI | InChI=1S/C13H29NO2/c1-6-14(7-2)11(5)13(16)12(15)9-8-10(3)4/h10-13,15-16H,6-9H2,1-5H3 |
| InChIKey | ZFPHSWPZKBQKSY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |