C8H19NO4 — CID 88965637
(2S,3S)-2-(dihydroxyamino)oxy-6-methylheptan-3-ol (PubChem CID 88965637) has the molecular formula C8H19NO4 and a molecular weight of 193.24 g/mol. Its IUPAC name is (2S,3S)-2-(dihydroxyamino)oxy-6-methylheptan-3-ol.
| Compound Name | (2S,3S)-2-(dihydroxyamino)oxy-6-methylheptan-3-ol |
|---|---|
| PubChem CID | 88965637 |
| Molecular Formula | C8H19NO4 |
| Molecular Weight | 193.24 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | (2S,3S)-2-(dihydroxyamino)oxy-6-methylheptan-3-ol |
| SMILES | CC(C)CC[C@H](O)[C@H](C)ON(O)O |
| InChI | InChI=1S/C8H19NO4/c1-6(2)4-5-8(10)7(3)13-9(11)12/h6-8,10-12H,4-5H2,1-3H3/t7-,8-/m0/s1 |
| InChIKey | KSVFJNIDPZKIOP-YUMQZZPRSA-N |
| XLogP | 1.18 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.24 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|