About carbanide;palladium;tricyclohexyl(prop-2-enyl)phosphanium
carbanide;palladium;tricyclohexyl(prop-2-enyl)phosphanium (PubChem CID 174436432) has the molecular formula C22H41PPd
and a molecular weight of 442.96 g/mol. Its IUPAC name is carbanide;palladium;tricyclohexyl(prop-2-enyl)phosphanium.
Molecular Properties
| Compound Name | carbanide;palladium;tricyclohexyl(prop-2-enyl)phosphanium |
| PubChem CID | 174436432 |
| Molecular Formula | C22H41PPd |
| Molecular Weight | 442.96 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | carbanide;palladium;tricyclohexyl(prop-2-enyl)phosphanium |
| SMILES | C=CC[P+](C1CCCCC1)(C1CCCCC1)C1CCCCC1.[CH3-].[Pd] |
| InChI | InChI=1S/C21H38P.CH3.Pd/c1-2-18-22(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21;;/h2,19-21H,1,3-18H2;1H3;/q+1;-1; |
| InChIKey | ZMSDEFPZUBXTST-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.96 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze carbanide;palladium;tricyclohexyl(prop-2-enyl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;palladium;tricyclohexyl(prop-2-enyl)phosphanium?
The IUPAC name of carbanide;palladium;tricyclohexyl(prop-2-enyl)phosphanium (CID 174436432) is carbanide;palladium;tricyclohexyl(prop-2-enyl)phosphanium.
What is the SMILES notation for carbanide;palladium;tricyclohexyl(prop-2-enyl)phosphanium?
The canonical SMILES for carbanide;palladium;tricyclohexyl(prop-2-enyl)phosphanium is C=CC[P+](C1CCCCC1)(C1CCCCC1)C1CCCCC1.[CH3-].[Pd].
What is the InChIKey of carbanide;palladium;tricyclohexyl(prop-2-enyl)phosphanium?
The InChIKey is ZMSDEFPZUBXTST-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H38P.CH3.Pd/c1-2-18-22(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21;;/h2,19-21H,1,3-18H2;1H3;/q+1;-1;.
What are the key properties of carbanide;palladium;tricyclohexyl(prop-2-enyl)phosphanium?
carbanide;palladium;tricyclohexyl(prop-2-enyl)phosphanium has a molecular weight of 442.96 g/mol, XLogP of 7.64, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;palladium;tricyclohexyl(prop-2-enyl)phosphanium is sourced from PubChem (CID 174436432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).