About cyclooctylcyclooctane;prop-2-en-1-ol
cyclooctylcyclooctane;prop-2-en-1-ol (PubChem CID 174488377) has the molecular formula C19H36O
and a molecular weight of 280.50 g/mol. Its IUPAC name is cyclooctylcyclooctane;prop-2-en-1-ol.
Molecular Properties
| Compound Name | cyclooctylcyclooctane;prop-2-en-1-ol |
| PubChem CID | 174488377 |
| Molecular Formula | C19H36O |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.28 |
| IUPAC Name | cyclooctylcyclooctane;prop-2-en-1-ol |
| SMILES | C1CCCC(C2CCCCCCC2)CCC1.C=CCO |
| InChI | InChI=1S/C16H30.C3H6O/c1-3-7-11-15(12-8-4-1)16-13-9-5-2-6-10-14-16;1-2-3-4/h15-16H,1-14H2;2,4H,1,3H2 |
| InChIKey | XLXBLXLOJHPDEH-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclooctylcyclooctane;prop-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclooctylcyclooctane;prop-2-en-1-ol?
The IUPAC name of cyclooctylcyclooctane;prop-2-en-1-ol (CID 174488377) is cyclooctylcyclooctane;prop-2-en-1-ol.
What is the SMILES notation for cyclooctylcyclooctane;prop-2-en-1-ol?
The canonical SMILES for cyclooctylcyclooctane;prop-2-en-1-ol is C1CCCC(C2CCCCCCC2)CCC1.C=CCO.
What is the InChIKey of cyclooctylcyclooctane;prop-2-en-1-ol?
The InChIKey is XLXBLXLOJHPDEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30.C3H6O/c1-3-7-11-15(12-8-4-1)16-13-9-5-2-6-10-14-16;1-2-3-4/h15-16H,1-14H2;2,4H,1,3H2.
What are the key properties of cyclooctylcyclooctane;prop-2-en-1-ol?
cyclooctylcyclooctane;prop-2-en-1-ol has a molecular weight of 280.50 g/mol, XLogP of 5.87, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclooctylcyclooctane;prop-2-en-1-ol is sourced from PubChem (CID 174488377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).