About 2-(diaminomethyl)hexanal
2-(diaminomethyl)hexanal (PubChem CID 174437838) has the molecular formula C7H16N2O
and a molecular weight of 144.22 g/mol. Its IUPAC name is 2-(diaminomethyl)hexanal.
Molecular Properties
| Compound Name | 2-(diaminomethyl)hexanal |
| PubChem CID | 174437838 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | 2-(diaminomethyl)hexanal |
| SMILES | CCCCC(C=O)C(N)N |
| InChI | InChI=1S/C7H16N2O/c1-2-3-4-6(5-10)7(8)9/h5-7H,2-4,8-9H2,1H3 |
| InChIKey | UHKBNLKYXYHAPR-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(diaminomethyl)hexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diaminomethyl)hexanal?
The IUPAC name of 2-(diaminomethyl)hexanal (CID 174437838) is 2-(diaminomethyl)hexanal.
What is the SMILES notation for 2-(diaminomethyl)hexanal?
The canonical SMILES for 2-(diaminomethyl)hexanal is CCCCC(C=O)C(N)N.
What is the InChIKey of 2-(diaminomethyl)hexanal?
The InChIKey is UHKBNLKYXYHAPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O/c1-2-3-4-6(5-10)7(8)9/h5-7H,2-4,8-9H2,1H3.
What are the key properties of 2-(diaminomethyl)hexanal?
2-(diaminomethyl)hexanal has a molecular weight of 144.22 g/mol, XLogP of 0.24, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diaminomethyl)hexanal is sourced from PubChem (CID 174437838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).