About bis[(4-acetylphenyl)carbamoyl] cyclohexane-1,2-dicarboxylate
bis[(4-acetylphenyl)carbamoyl] cyclohexane-1,2-dicarboxylate (PubChem CID 174440183) has the molecular formula C26H26N2O8
and a molecular weight of 494.50 g/mol. Its IUPAC name is bis[(4-acetylphenyl)carbamoyl] cyclohexane-1,2-dicarboxylate.
Molecular Properties
| Compound Name | bis[(4-acetylphenyl)carbamoyl] cyclohexane-1,2-dicarboxylate |
| PubChem CID | 174440183 |
| Molecular Formula | C26H26N2O8 |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | bis[(4-acetylphenyl)carbamoyl] cyclohexane-1,2-dicarboxylate |
| SMILES | CC(=O)c1ccc(NC(=O)OC(=O)C2CCCCC2C(=O)OC(=O)Nc2ccc(C(C)=O)cc2)cc1 |
| InChI | InChI=1S/C26H26N2O8/c1-15(29)17-7-11-19(12-8-17)27-25(33)35-23(31)21-5-3-4-6-22(21)24(32)36-26(34)28-20-13-9-18(10-14-20)16(2)30/h7-14,21-22H,3-6H2,1-2H3,(H,27,33)(H,28,34) |
| InChIKey | XLRMYNDIMSGYBY-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze bis[(4-acetylphenyl)carbamoyl] cyclohexane-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[(4-acetylphenyl)carbamoyl] cyclohexane-1,2-dicarboxylate?
The IUPAC name of bis[(4-acetylphenyl)carbamoyl] cyclohexane-1,2-dicarboxylate (CID 174440183) is bis[(4-acetylphenyl)carbamoyl] cyclohexane-1,2-dicarboxylate.
What is the SMILES notation for bis[(4-acetylphenyl)carbamoyl] cyclohexane-1,2-dicarboxylate?
The canonical SMILES for bis[(4-acetylphenyl)carbamoyl] cyclohexane-1,2-dicarboxylate is CC(=O)c1ccc(NC(=O)OC(=O)C2CCCCC2C(=O)OC(=O)Nc2ccc(C(C)=O)cc2)cc1.
What is the InChIKey of bis[(4-acetylphenyl)carbamoyl] cyclohexane-1,2-dicarboxylate?
The InChIKey is XLRMYNDIMSGYBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H26N2O8/c1-15(29)17-7-11-19(12-8-17)27-25(33)35-23(31)21-5-3-4-6-22(21)24(32)36-26(34)28-20-13-9-18(10-14-20)16(2)30/h7-14,21-22H,3-6H2,1-2H3,(H,27,33)(H,28,34).
What are the key properties of bis[(4-acetylphenyl)carbamoyl] cyclohexane-1,2-dicarboxylate?
bis[(4-acetylphenyl)carbamoyl] cyclohexane-1,2-dicarboxylate has a molecular weight of 494.50 g/mol, XLogP of 4.75, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis[(4-acetylphenyl)carbamoyl] cyclohexane-1,2-dicarboxylate is sourced from PubChem (CID 174440183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).