C29H28N2O2 — CID 174440958
[2-phenyl-3-[(4-phenylpiperidin-1-yl)methyl]quinolin-4-yl] acetate (PubChem CID 174440958) has the molecular formula C29H28N2O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is [2-phenyl-3-[(4-phenylpiperidin-1-yl)methyl]quinolin-4-yl] acetate.
| Compound Name | [2-phenyl-3-[(4-phenylpiperidin-1-yl)methyl]quinolin-4-yl] acetate |
|---|---|
| PubChem CID | 174440958 |
| Molecular Formula | C29H28N2O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | [2-phenyl-3-[(4-phenylpiperidin-1-yl)methyl]quinolin-4-yl] acetate |
| SMILES | CC(=O)Oc1c(CN2CCC(c3ccccc3)CC2)c(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C29H28N2O2/c1-21(32)33-29-25-14-8-9-15-27(25)30-28(24-12-6-3-7-13-24)26(29)20-31-18-16-23(17-19-31)22-10-4-2-5-11-22/h2-15,23H,16-20H2,1H3 |
| InChIKey | OOLVZKZCIDFKHG-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |