C22H18ClFIN5O6 — CID 174442096
2-(2-chloro-4-iodoanilino)-4-[4-(ethoxycarbamoyl)anilino]-3-fluoro-N-hydroxy-5-nitrobenzamide (PubChem CID 174442096) has the molecular formula C22H18ClFIN5O6 and a molecular weight of 629.77 g/mol. Its IUPAC name is 2-(2-chloro-4-iodoanilino)-4-[4-(ethoxycarbamoyl)anilino]-3-fluoro-N-hydroxy-5-nitrobenzamide.
| Compound Name | 2-(2-chloro-4-iodoanilino)-4-[4-(ethoxycarbamoyl)anilino]-3-fluoro-N-hydroxy-5-nitrobenzamide |
|---|---|
| PubChem CID | 174442096 |
| Molecular Formula | C22H18ClFIN5O6 |
| Molecular Weight | 629.77 g/mol |
| Exact Mass | 629.00 |
| IUPAC Name | 2-(2-chloro-4-iodoanilino)-4-[4-(ethoxycarbamoyl)anilino]-3-fluoro-N-hydroxy-5-nitrobenzamide |
| SMILES | CCONC(=O)c1ccc(Nc2c([N+](=O)[O-])cc(C(=O)NO)c(Nc3ccc(I)cc3Cl)c2F)cc1 |
| InChI | InChI=1S/C22H18ClFIN5O6/c1-2-36-29-21(31)11-3-6-13(7-4-11)26-20-17(30(34)35)10-14(22(32)28-33)19(18(20)24)27-16-8-5-12(25)9-15(16)23/h3-10,26-27,33H,2H2,1H3,(H,28,32)(H,29,31) |
| InChIKey | CNVFUWYLBYXOQE-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 154.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.77 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|