C19H12ClFIN4O5SW- — CID 59032862
4-[3-(2-chloro-4-iodoanilino)-2-fluoro-6-nitro-4-(oxomethyl)anilino]benzenesulfonamide;tungsten (PubChem CID 59032862) has the molecular formula C19H12ClFIN4O5SW- and a molecular weight of 773.59 g/mol. Its IUPAC name is 4-[3-(2-chloro-4-iodoanilino)-2-fluoro-6-nitro-4-(oxomethyl)anilino]benzenesulfonamide;tungsten.
| Compound Name | 4-[3-(2-chloro-4-iodoanilino)-2-fluoro-6-nitro-4-(oxomethyl)anilino]benzenesulfonamide;tungsten |
|---|---|
| PubChem CID | 59032862 |
| Molecular Formula | C19H12ClFIN4O5SW- |
| Molecular Weight | 773.59 g/mol |
| Exact Mass | 772.88 |
| IUPAC Name | 4-[3-(2-chloro-4-iodoanilino)-2-fluoro-6-nitro-4-(oxomethyl)anilino]benzenesulfonamide;tungsten |
| SMILES | NS(=O)(=O)c1ccc(Nc2c([N+](=O)[O-])cc([C-]=O)c(Nc3ccc(I)cc3Cl)c2F)cc1.[W] |
| InChI | InChI=1S/C19H12ClFIN4O5S.W/c20-14-8-11(22)1-6-15(14)25-18-10(9-27)7-16(26(28)29)19(17(18)21)24-12-2-4-13(5-3-12)32(23,30)31;/h1-8,24-25H,(H2,23,30,31);/q-1; |
| InChIKey | PBWZMBRLONBWCK-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 144.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.59 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|