About azane;2-oxalooxysulfonyloxy-2-oxoacetic acid
azane;2-oxalooxysulfonyloxy-2-oxoacetic acid (PubChem CID 174442656) has the molecular formula C4H8N2O10S
and a molecular weight of 276.18 g/mol. Its IUPAC name is azane;2-oxalooxysulfonyloxy-2-oxoacetic acid.
Molecular Properties
| Compound Name | azane;2-oxalooxysulfonyloxy-2-oxoacetic acid |
| PubChem CID | 174442656 |
| Molecular Formula | C4H8N2O10S |
| Molecular Weight | 276.18 g/mol |
| Exact Mass | 275.99 |
| IUPAC Name | azane;2-oxalooxysulfonyloxy-2-oxoacetic acid |
| SMILES | N.N.O=C(O)C(=O)OS(=O)(=O)OC(=O)C(=O)O |
| InChI | InChI=1S/C4H2O10S.2H3N/c5-1(6)3(9)13-15(11,12)14-4(10)2(7)8;;/h(H,5,6)(H,7,8);2*1H3 |
| InChIKey | HHROQMINAIPVQD-UHFFFAOYSA-N |
| XLogP | -2.19 |
| TPSA | 231.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.18 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze azane;2-oxalooxysulfonyloxy-2-oxoacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-oxalooxysulfonyloxy-2-oxoacetic acid?
The IUPAC name of azane;2-oxalooxysulfonyloxy-2-oxoacetic acid (CID 174442656) is azane;2-oxalooxysulfonyloxy-2-oxoacetic acid.
What is the SMILES notation for azane;2-oxalooxysulfonyloxy-2-oxoacetic acid?
The canonical SMILES for azane;2-oxalooxysulfonyloxy-2-oxoacetic acid is N.N.O=C(O)C(=O)OS(=O)(=O)OC(=O)C(=O)O.
What is the InChIKey of azane;2-oxalooxysulfonyloxy-2-oxoacetic acid?
The InChIKey is HHROQMINAIPVQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2O10S.2H3N/c5-1(6)3(9)13-15(11,12)14-4(10)2(7)8;;/h(H,5,6)(H,7,8);2*1H3.
What are the key properties of azane;2-oxalooxysulfonyloxy-2-oxoacetic acid?
azane;2-oxalooxysulfonyloxy-2-oxoacetic acid has a molecular weight of 276.18 g/mol, XLogP of -2.19, 2 rotatable bonds, 4 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-oxalooxysulfonyloxy-2-oxoacetic acid is sourced from PubChem (CID 174442656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).