C27H32O4 — CID 174444098
3-[4-[5-[[4-(hydroxymethyl)phenyl]methoxy]-2-methoxyphenyl]-3-methylphenyl]pentan-3-ol (PubChem CID 174444098) has the molecular formula C27H32O4 and a molecular weight of 420.55 g/mol. Its IUPAC name is 3-[4-[5-[[4-(hydroxymethyl)phenyl]methoxy]-2-methoxyphenyl]-3-methylphenyl]pentan-3-ol.
| Compound Name | 3-[4-[5-[[4-(hydroxymethyl)phenyl]methoxy]-2-methoxyphenyl]-3-methylphenyl]pentan-3-ol |
|---|---|
| PubChem CID | 174444098 |
| Molecular Formula | C27H32O4 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 3-[4-[5-[[4-(hydroxymethyl)phenyl]methoxy]-2-methoxyphenyl]-3-methylphenyl]pentan-3-ol |
| SMILES | CCC(O)(CC)c1ccc(-c2cc(OCc3ccc(CO)cc3)ccc2OC)c(C)c1 |
| InChI | InChI=1S/C27H32O4/c1-5-27(29,6-2)22-11-13-24(19(3)15-22)25-16-23(12-14-26(25)30-4)31-18-21-9-7-20(17-28)8-10-21/h7-16,28-29H,5-6,17-18H2,1-4H3 |
| InChIKey | ZCDOLBLVFUUTJI-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |