C25H29NO4 — CID 174457698
3-[6-[3-[[3-(hydroxymethyl)-4-methoxyphenyl]methoxy]phenyl]-3-pyridinyl]pentan-3-ol (PubChem CID 174457698) has the molecular formula C25H29NO4 and a molecular weight of 407.51 g/mol. Its IUPAC name is 3-[6-[3-[[3-(hydroxymethyl)-4-methoxyphenyl]methoxy]phenyl]-3-pyridinyl]pentan-3-ol.
| Compound Name | 3-[6-[3-[[3-(hydroxymethyl)-4-methoxyphenyl]methoxy]phenyl]-3-pyridinyl]pentan-3-ol |
|---|---|
| PubChem CID | 174457698 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 3-[6-[3-[[3-(hydroxymethyl)-4-methoxyphenyl]methoxy]phenyl]-3-pyridinyl]pentan-3-ol |
| SMILES | CCC(O)(CC)c1ccc(-c2cccc(OCc3ccc(OC)c(CO)c3)c2)nc1 |
| InChI | InChI=1S/C25H29NO4/c1-4-25(28,5-2)21-10-11-23(26-15-21)19-7-6-8-22(14-19)30-17-18-9-12-24(29-3)20(13-18)16-27/h6-15,27-28H,4-5,16-17H2,1-3H3 |
| InChIKey | UAXVUSNXQKTINR-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |