C21H29NO5 — CID 174445541
[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2-oxocyclohexyl)phenyl]methyl propanoate (PubChem CID 174445541) has the molecular formula C21H29NO5 and a molecular weight of 375.47 g/mol. Its IUPAC name is [2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2-oxocyclohexyl)phenyl]methyl propanoate.
| Compound Name | [2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2-oxocyclohexyl)phenyl]methyl propanoate |
|---|---|
| PubChem CID | 174445541 |
| Molecular Formula | C21H29NO5 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | [2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2-oxocyclohexyl)phenyl]methyl propanoate |
| SMILES | CCC(=O)OCc1cccc(C2CCCCC2=O)c1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H29NO5/c1-5-18(24)26-13-14-9-8-11-16(15-10-6-7-12-17(15)23)19(14)22-20(25)27-21(2,3)4/h8-9,11,15H,5-7,10,12-13H2,1-4H3,(H,22,25) |
| InChIKey | HMCHAUJJGNFXLM-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |