C21H25NO5 — CID 174783944
[3-(3-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]methyl propanoate (PubChem CID 174783944) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is [3-(3-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]methyl propanoate.
| Compound Name | [3-(3-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]methyl propanoate |
|---|---|
| PubChem CID | 174783944 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | [3-(3-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]methyl propanoate |
| SMILES | CCC(=O)OCc1cccc(-c2cccc(O)c2)c1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H25NO5/c1-5-18(24)26-13-15-9-7-11-17(14-8-6-10-16(23)12-14)19(15)22-20(25)27-21(2,3)4/h6-12,23H,5,13H2,1-4H3,(H,22,25) |
| InChIKey | KAJBRERWOLTDKL-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |