About dibutyl-ethoxy-(5-methylnonan-5-yloxy)stannane;hydrate
dibutyl-ethoxy-(5-methylnonan-5-yloxy)stannane;hydrate (PubChem CID 174445619) has the molecular formula C20H46O3Sn
and a molecular weight of 453.30 g/mol. Its IUPAC name is dibutyl-ethoxy-(5-methylnonan-5-yloxy)stannane;hydrate.
Molecular Properties
| Compound Name | dibutyl-ethoxy-(5-methylnonan-5-yloxy)stannane;hydrate |
| PubChem CID | 174445619 |
| Molecular Formula | C20H46O3Sn |
| Molecular Weight | 453.30 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | dibutyl-ethoxy-(5-methylnonan-5-yloxy)stannane;hydrate |
| SMILES | CCCCC(C)(CCCC)O[Sn](CCCC)(CCCC)OCC.O |
| InChI | InChI=1S/C10H21O.2C4H9.C2H5O.H2O.Sn/c1-4-6-8-10(3,11)9-7-5-2;2*1-3-4-2;1-2-3;;/h4-9H2,1-3H3;2*1,3-4H2,2H3;2H2,1H3;1H2;/q-1;;;-1;;+2 |
| InChIKey | LWORUDPWHUURRR-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 49.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.30 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze dibutyl-ethoxy-(5-methylnonan-5-yloxy)stannane;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutyl-ethoxy-(5-methylnonan-5-yloxy)stannane;hydrate?
The IUPAC name of dibutyl-ethoxy-(5-methylnonan-5-yloxy)stannane;hydrate (CID 174445619) is dibutyl-ethoxy-(5-methylnonan-5-yloxy)stannane;hydrate.
What is the SMILES notation for dibutyl-ethoxy-(5-methylnonan-5-yloxy)stannane;hydrate?
The canonical SMILES for dibutyl-ethoxy-(5-methylnonan-5-yloxy)stannane;hydrate is CCCCC(C)(CCCC)O[Sn](CCCC)(CCCC)OCC.O.
What is the InChIKey of dibutyl-ethoxy-(5-methylnonan-5-yloxy)stannane;hydrate?
The InChIKey is LWORUDPWHUURRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21O.2C4H9.C2H5O.H2O.Sn/c1-4-6-8-10(3,11)9-7-5-2;2*1-3-4-2;1-2-3;;/h4-9H2,1-3H3;2*1,3-4H2,2H3;2H2,1H3;1H2;/q-1;;;-1;;+2.
What are the key properties of dibutyl-ethoxy-(5-methylnonan-5-yloxy)stannane;hydrate?
dibutyl-ethoxy-(5-methylnonan-5-yloxy)stannane;hydrate has a molecular weight of 453.30 g/mol, XLogP of 6.40, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dibutyl-ethoxy-(5-methylnonan-5-yloxy)stannane;hydrate is sourced from PubChem (CID 174445619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).