C22H17N3O5 — CID 174449262
3-hydroxy-1-[3-(4-methoxyphenoxy)furan-2-yl]-3-[2-(1H-1,2,4-triazol-5-yl)phenyl]prop-2-en-1-one (PubChem CID 174449262) has the molecular formula C22H17N3O5 and a molecular weight of 403.39 g/mol. Its IUPAC name is 3-hydroxy-1-[3-(4-methoxyphenoxy)furan-2-yl]-3-[2-(1H-1,2,4-triazol-5-yl)phenyl]prop-2-en-1-one.
| Compound Name | 3-hydroxy-1-[3-(4-methoxyphenoxy)furan-2-yl]-3-[2-(1H-1,2,4-triazol-5-yl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 174449262 |
| Molecular Formula | C22H17N3O5 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 3-hydroxy-1-[3-(4-methoxyphenoxy)furan-2-yl]-3-[2-(1H-1,2,4-triazol-5-yl)phenyl]prop-2-en-1-one |
| SMILES | COc1ccc(Oc2ccoc2C(=O)C=C(O)c2ccccc2-c2ncn[nH]2)cc1 |
| InChI | InChI=1S/C22H17N3O5/c1-28-14-6-8-15(9-7-14)30-20-10-11-29-21(20)19(27)12-18(26)16-4-2-3-5-17(16)22-23-13-24-25-22/h2-13,26H,1H3,(H,23,24,25) |
| InChIKey | BIKXZLNMWAWIMF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 110.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|