C16H14O6 — CID 69139515
(Z)-2-hydroxy-4-[3-[(4-methoxyphenyl)methyl]furan-2-yl]-4-oxobut-2-enoic acid (PubChem CID 69139515) has the molecular formula C16H14O6 and a molecular weight of 302.28 g/mol. Its IUPAC name is (Z)-2-hydroxy-4-[3-[(4-methoxyphenyl)methyl]furan-2-yl]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-2-hydroxy-4-[3-[(4-methoxyphenyl)methyl]furan-2-yl]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 69139515 |
| Molecular Formula | C16H14O6 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | (Z)-2-hydroxy-4-[3-[(4-methoxyphenyl)methyl]furan-2-yl]-4-oxobut-2-enoic acid |
| SMILES | COc1ccc(Cc2ccoc2C(=O)/C=C(\O)C(=O)O)cc1 |
| InChI | InChI=1S/C16H14O6/c1-21-12-4-2-10(3-5-12)8-11-6-7-22-15(11)13(17)9-14(18)16(19)20/h2-7,9,18H,8H2,1H3,(H,19,20)/b14-9- |
| InChIKey | MQBATIKZISKUMG-ZROIWOOFSA-N |
| XLogP | 2.59 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|