About (7-nitro-1H-indol-3-yl) formate
(7-nitro-1H-indol-3-yl) formate (PubChem CID 174450911) has the molecular formula C9H6N2O4
and a molecular weight of 206.16 g/mol. Its IUPAC name is (7-nitro-1H-indol-3-yl) formate.
Molecular Properties
| Compound Name | (7-nitro-1H-indol-3-yl) formate |
| PubChem CID | 174450911 |
| Molecular Formula | C9H6N2O4 |
| Molecular Weight | 206.16 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | (7-nitro-1H-indol-3-yl) formate |
| SMILES | O=COc1c[nH]c2c([N+](=O)[O-])cccc12 |
| InChI | InChI=1S/C9H6N2O4/c12-5-15-8-4-10-9-6(8)2-1-3-7(9)11(13)14/h1-5,10H |
| InChIKey | YWNZUQQQXNVPMQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.16 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (7-nitro-1H-indol-3-yl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-nitro-1H-indol-3-yl) formate?
The IUPAC name of (7-nitro-1H-indol-3-yl) formate (CID 174450911) is (7-nitro-1H-indol-3-yl) formate.
What is the SMILES notation for (7-nitro-1H-indol-3-yl) formate?
The canonical SMILES for (7-nitro-1H-indol-3-yl) formate is O=COc1c[nH]c2c([N+](=O)[O-])cccc12.
What is the InChIKey of (7-nitro-1H-indol-3-yl) formate?
The InChIKey is YWNZUQQQXNVPMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O4/c12-5-15-8-4-10-9-6(8)2-1-3-7(9)11(13)14/h1-5,10H.
What are the key properties of (7-nitro-1H-indol-3-yl) formate?
(7-nitro-1H-indol-3-yl) formate has a molecular weight of 206.16 g/mol, XLogP of 1.61, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7-nitro-1H-indol-3-yl) formate is sourced from PubChem (CID 174450911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).