C24H26FN5O — CID 174452652
4-[3-ethoxy-4-(4-fluorophenyl)-2-methyl-1H-triazol-5-yl]-N-(1-phenylethyl)pyridin-2-amine (PubChem CID 174452652) has the molecular formula C24H26FN5O and a molecular weight of 419.50 g/mol. Its IUPAC name is 4-[3-ethoxy-4-(4-fluorophenyl)-2-methyl-1H-triazol-5-yl]-N-(1-phenylethyl)pyridin-2-amine.
| Compound Name | 4-[3-ethoxy-4-(4-fluorophenyl)-2-methyl-1H-triazol-5-yl]-N-(1-phenylethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 174452652 |
| Molecular Formula | C24H26FN5O |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 4-[3-ethoxy-4-(4-fluorophenyl)-2-methyl-1H-triazol-5-yl]-N-(1-phenylethyl)pyridin-2-amine |
| SMILES | CCON1C(c2ccc(F)cc2)=C(c2ccnc(NC(C)c3ccccc3)c2)NN1C |
| InChI | InChI=1S/C24H26FN5O/c1-4-31-30-24(19-10-12-21(25)13-11-19)23(28-29(30)3)20-14-15-26-22(16-20)27-17(2)18-8-6-5-7-9-18/h5-17,28H,4H2,1-3H3,(H,26,27) |
| InChIKey | JRIATKWMKXPVSJ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 52.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |