C17H20N2O — CID 68686090
4-[(E)-2-ethoxyethenyl]-N-[(1S)-1-phenylethyl]pyridin-2-amine (PubChem CID 68686090) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is 4-[(E)-2-ethoxyethenyl]-N-[(1S)-1-phenylethyl]pyridin-2-amine.
| Compound Name | 4-[(E)-2-ethoxyethenyl]-N-[(1S)-1-phenylethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 68686090 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 4-[(E)-2-ethoxyethenyl]-N-[(1S)-1-phenylethyl]pyridin-2-amine |
| SMILES | CCO/C=C/c1ccnc(N[C@@H](C)c2ccccc2)c1 |
| InChI | InChI=1S/C17H20N2O/c1-3-20-12-10-15-9-11-18-17(13-15)19-14(2)16-7-5-4-6-8-16/h4-14H,3H2,1-2H3,(H,18,19)/b12-10+/t14-/m0/s1 |
| InChIKey | SNIDGBAFCUODKR-WONIAPNHSA-N |
| XLogP | 4.26 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|