C47H42N4O3 — CID 174454571
bis[2-[2-ethyl-1-[4-(2-hydroxyethyl)phenyl]benzimidazol-5-yl]phenyl]methanone (PubChem CID 174454571) has the molecular formula C47H42N4O3 and a molecular weight of 710.88 g/mol. Its IUPAC name is bis[2-[2-ethyl-1-[4-(2-hydroxyethyl)phenyl]benzimidazol-5-yl]phenyl]methanone.
| Compound Name | bis[2-[2-ethyl-1-[4-(2-hydroxyethyl)phenyl]benzimidazol-5-yl]phenyl]methanone |
|---|---|
| PubChem CID | 174454571 |
| Molecular Formula | C47H42N4O3 |
| Molecular Weight | 710.88 g/mol |
| Exact Mass | 710.33 |
| IUPAC Name | bis[2-[2-ethyl-1-[4-(2-hydroxyethyl)phenyl]benzimidazol-5-yl]phenyl]methanone |
| SMILES | CCc1nc2cc(-c3ccccc3C(=O)c3ccccc3-c3ccc4c(c3)nc(CC)n4-c3ccc(CCO)cc3)ccc2n1-c1ccc(CCO)cc1 |
| InChI | InChI=1S/C47H42N4O3/c1-3-45-48-41-29-33(17-23-43(41)50(45)35-19-13-31(14-20-35)25-27-52)37-9-5-7-11-39(37)47(54)40-12-8-6-10-38(40)34-18-24-44-42(30-34)49-46(4-2)51(44)36-21-15-32(16-22-36)26-28-53/h5-24,29-30,52-53H,3-4,25-28H2,1-2H3 |
| InChIKey | NKOCKAKDQYXIKY-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.88 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |