C22H21F3N2O3 — CID 90820409
5-[4-[2-ethyl-5-(2,2,2-trifluoroacetyl)benzimidazol-1-yl]phenyl]pentanoic acid (PubChem CID 90820409) has the molecular formula C22H21F3N2O3 and a molecular weight of 418.42 g/mol. Its IUPAC name is 5-[4-[2-ethyl-5-(2,2,2-trifluoroacetyl)benzimidazol-1-yl]phenyl]pentanoic acid.
| Compound Name | 5-[4-[2-ethyl-5-(2,2,2-trifluoroacetyl)benzimidazol-1-yl]phenyl]pentanoic acid |
|---|---|
| PubChem CID | 90820409 |
| Molecular Formula | C22H21F3N2O3 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 5-[4-[2-ethyl-5-(2,2,2-trifluoroacetyl)benzimidazol-1-yl]phenyl]pentanoic acid |
| SMILES | CCc1nc2cc(C(=O)C(F)(F)F)ccc2n1-c1ccc(CCCCC(=O)O)cc1 |
| InChI | InChI=1S/C22H21F3N2O3/c1-2-19-26-17-13-15(21(30)22(23,24)25)9-12-18(17)27(19)16-10-7-14(8-11-16)5-3-4-6-20(28)29/h7-13H,2-6H2,1H3,(H,28,29) |
| InChIKey | IBSWVTVJEJOBBQ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|