C21H18FIN5O3S+ — CID 174454940
[5-fluoro-2-(4-iodo-2-methylanilino)benzoyl]imino-[[4-(sulfinoamino)phenyl]methylimino]azanium (PubChem CID 174454940) has the molecular formula C21H18FIN5O3S+ and a molecular weight of 566.38 g/mol. Its IUPAC name is [5-fluoro-2-(4-iodo-2-methylanilino)benzoyl]imino-[[4-(sulfinoamino)phenyl]methylimino]azanium.
| Compound Name | [5-fluoro-2-(4-iodo-2-methylanilino)benzoyl]imino-[[4-(sulfinoamino)phenyl]methylimino]azanium |
|---|---|
| PubChem CID | 174454940 |
| Molecular Formula | C21H18FIN5O3S+ |
| Molecular Weight | 566.38 g/mol |
| Exact Mass | 566.02 |
| IUPAC Name | [5-fluoro-2-(4-iodo-2-methylanilino)benzoyl]imino-[[4-(sulfinoamino)phenyl]methylimino]azanium |
| SMILES | Cc1cc(I)ccc1Nc1ccc(F)cc1C(=O)N=[N+]=NCc1ccc(NS(=O)O)cc1 |
| InChI | InChI=1S/C21H17FIN5O3S/c1-13-10-16(23)5-9-19(13)25-20-8-4-15(22)11-18(20)21(29)26-28-24-12-14-2-6-17(7-3-14)27-32(30)31/h2-11,27H,12H2,1H3,(H-,25,29,30,31)/p+1 |
| InChIKey | ZIQUQOSZWLRYJJ-UHFFFAOYSA-O |
| XLogP | 5.34 |
| TPSA | 117.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.38 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|