C24H25ClN4O4S2 — CID 174460785
2-[4-[1-(6-chloro-1-benzothiophen-2-yl)prop-2-enylsulfonyl]-2-oxopiperazin-1-yl]-N-(2-pyridin-3-ylethyl)acetamide (PubChem CID 174460785) has the molecular formula C24H25ClN4O4S2 and a molecular weight of 533.08 g/mol. Its IUPAC name is 2-[4-[1-(6-chloro-1-benzothiophen-2-yl)prop-2-enylsulfonyl]-2-oxopiperazin-1-yl]-N-(2-pyridin-3-ylethyl)acetamide.
| Compound Name | 2-[4-[1-(6-chloro-1-benzothiophen-2-yl)prop-2-enylsulfonyl]-2-oxopiperazin-1-yl]-N-(2-pyridin-3-ylethyl)acetamide |
|---|---|
| PubChem CID | 174460785 |
| Molecular Formula | C24H25ClN4O4S2 |
| Molecular Weight | 533.08 g/mol |
| Exact Mass | 532.10 |
| IUPAC Name | 2-[4-[1-(6-chloro-1-benzothiophen-2-yl)prop-2-enylsulfonyl]-2-oxopiperazin-1-yl]-N-(2-pyridin-3-ylethyl)acetamide |
| SMILES | C=CC(c1cc2ccc(Cl)cc2s1)S(=O)(=O)N1CCN(CC(=O)NCCc2cccnc2)C(=O)C1 |
| InChI | InChI=1S/C24H25ClN4O4S2/c1-2-22(21-12-18-5-6-19(25)13-20(18)34-21)35(32,33)29-11-10-28(24(31)16-29)15-23(30)27-9-7-17-4-3-8-26-14-17/h2-6,8,12-14,22H,1,7,9-11,15-16H2,(H,27,30) |
| InChIKey | ABSJFTWGNYIXEI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.08 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|