C25H28ClN5O6S2 — CID 174447687
2-[5-[2-[[2-[4-[1-(6-chloro-1-benzothiophen-2-yl)prop-2-enylsulfonyl]-2-oxopiperazin-1-yl]acetyl]amino]ethyl]imidazol-1-yl]ethyl formate (PubChem CID 174447687) has the molecular formula C25H28ClN5O6S2 and a molecular weight of 594.12 g/mol. Its IUPAC name is 2-[5-[2-[[2-[4-[1-(6-chloro-1-benzothiophen-2-yl)prop-2-enylsulfonyl]-2-oxopiperazin-1-yl]acetyl]amino]ethyl]imidazol-1-yl]ethyl formate.
| Compound Name | 2-[5-[2-[[2-[4-[1-(6-chloro-1-benzothiophen-2-yl)prop-2-enylsulfonyl]-2-oxopiperazin-1-yl]acetyl]amino]ethyl]imidazol-1-yl]ethyl formate |
|---|---|
| PubChem CID | 174447687 |
| Molecular Formula | C25H28ClN5O6S2 |
| Molecular Weight | 594.12 g/mol |
| Exact Mass | 593.12 |
| IUPAC Name | 2-[5-[2-[[2-[4-[1-(6-chloro-1-benzothiophen-2-yl)prop-2-enylsulfonyl]-2-oxopiperazin-1-yl]acetyl]amino]ethyl]imidazol-1-yl]ethyl formate |
| SMILES | C=CC(c1cc2ccc(Cl)cc2s1)S(=O)(=O)N1CCN(CC(=O)NCCc2cncn2CCOC=O)C(=O)C1 |
| InChI | InChI=1S/C25H28ClN5O6S2/c1-2-23(22-11-18-3-4-19(26)12-21(18)38-22)39(35,36)31-8-7-29(25(34)15-31)14-24(33)28-6-5-20-13-27-16-30(20)9-10-37-17-32/h2-4,11-13,16-17,23H,1,5-10,14-15H2,(H,28,33) |
| InChIKey | LOUHMPIARLHPLC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 130.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.12 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|