C17H20ClN3O2S3 — CID 175240560
2-[4-[1-(6-chloro-1-benzothiophen-2-yl)prop-2-enylsulfonyl]piperazin-1-yl]ethanethioamide (PubChem CID 175240560) has the molecular formula C17H20ClN3O2S3 and a molecular weight of 430.02 g/mol. Its IUPAC name is 2-[4-[1-(6-chloro-1-benzothiophen-2-yl)prop-2-enylsulfonyl]piperazin-1-yl]ethanethioamide.
| Compound Name | 2-[4-[1-(6-chloro-1-benzothiophen-2-yl)prop-2-enylsulfonyl]piperazin-1-yl]ethanethioamide |
|---|---|
| PubChem CID | 175240560 |
| Molecular Formula | C17H20ClN3O2S3 |
| Molecular Weight | 430.02 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | 2-[4-[1-(6-chloro-1-benzothiophen-2-yl)prop-2-enylsulfonyl]piperazin-1-yl]ethanethioamide |
| SMILES | C=CC(c1cc2ccc(Cl)cc2s1)S(=O)(=O)N1CCN(CC(N)=S)CC1 |
| InChI | InChI=1S/C17H20ClN3O2S3/c1-2-16(15-9-12-3-4-13(18)10-14(12)25-15)26(22,23)21-7-5-20(6-8-21)11-17(19)24/h2-4,9-10,16H,1,5-8,11H2,(H2,19,24) |
| InChIKey | WOJDYLIPEIUSIU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.02 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|