C10H11ClN2S — CID 130749964
(1R)-1-(6-chloro-1-benzothiophen-2-yl)ethane-1,2-diamine (PubChem CID 130749964) has the molecular formula C10H11ClN2S and a molecular weight of 226.73 g/mol. Its IUPAC name is (1R)-1-(6-chloro-1-benzothiophen-2-yl)ethane-1,2-diamine.
| Compound Name | (1R)-1-(6-chloro-1-benzothiophen-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 130749964 |
| Molecular Formula | C10H11ClN2S |
| Molecular Weight | 226.73 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | (1R)-1-(6-chloro-1-benzothiophen-2-yl)ethane-1,2-diamine |
| SMILES | NC[C@@H](N)c1cc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C10H11ClN2S/c11-7-2-1-6-3-10(8(13)5-12)14-9(6)4-7/h1-4,8H,5,12-13H2/t8-/m1/s1 |
| InChIKey | YUYYTUDUOYDWFT-MRVPVSSYSA-N |
| XLogP | 2.51 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.73 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |