C8H12ClN3 — CID 55270734
1-(2-amino-4-chlorophenyl)ethane-1,2-diamine (PubChem CID 55270734) has the molecular formula C8H12ClN3 and a molecular weight of 185.66 g/mol. Its IUPAC name is 1-(2-amino-4-chlorophenyl)ethane-1,2-diamine.
| Compound Name | 1-(2-amino-4-chlorophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 55270734 |
| Molecular Formula | C8H12ClN3 |
| Molecular Weight | 185.66 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 1-(2-amino-4-chlorophenyl)ethane-1,2-diamine |
| SMILES | NCC(N)c1ccc(Cl)cc1N |
| InChI | InChI=1S/C8H12ClN3/c9-5-1-2-6(7(11)3-5)8(12)4-10/h1-3,8H,4,10-12H2 |
| InChIKey | QSBQKDJMOHKRIJ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.66 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|