C42H56O12 — CID 174461451
benzoic acid;2-butylpentane-1,3-diol;pentane-1,1-diol (PubChem CID 174461451) has the molecular formula C42H56O12 and a molecular weight of 752.90 g/mol. Its IUPAC name is benzoic acid;2-butylpentane-1,3-diol;pentane-1,1-diol.
| Compound Name | benzoic acid;2-butylpentane-1,3-diol;pentane-1,1-diol |
|---|---|
| PubChem CID | 174461451 |
| Molecular Formula | C42H56O12 |
| Molecular Weight | 752.90 g/mol |
| Exact Mass | 752.38 |
| IUPAC Name | benzoic acid;2-butylpentane-1,3-diol;pentane-1,1-diol |
| SMILES | CCCCC(CO)C(O)CC.CCCCC(O)O.O=C(O)c1ccccc1.O=C(O)c1ccccc1.O=C(O)c1ccccc1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C9H20O2.4C7H6O2.C5H12O2/c1-3-5-6-8(7-10)9(11)4-2;4*8-7(9)6-4-2-1-3-5-6;1-2-3-4-5(6)7/h8-11H,3-7H2,1-2H3;4*1-5H,(H,8,9);5-7H,2-4H2,1H3 |
| InChIKey | FPTKKSBCDDXEEU-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 230.12 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.90 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|