C20H36O6 — CID 175478207
2-butylpentane-1,3-diol;methyl benzoate;propane-1,2-diol (PubChem CID 175478207) has the molecular formula C20H36O6 and a molecular weight of 372.50 g/mol. Its IUPAC name is 2-butylpentane-1,3-diol;methyl benzoate;propane-1,2-diol.
| Compound Name | 2-butylpentane-1,3-diol;methyl benzoate;propane-1,2-diol |
|---|---|
| PubChem CID | 175478207 |
| Molecular Formula | C20H36O6 |
| Molecular Weight | 372.50 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | 2-butylpentane-1,3-diol;methyl benzoate;propane-1,2-diol |
| SMILES | CC(O)CO.CCCCC(CO)C(O)CC.COC(=O)c1ccccc1 |
| InChI | InChI=1S/C9H20O2.C8H8O2.C3H8O2/c1-3-5-6-8(7-10)9(11)4-2;1-10-8(9)7-5-3-2-4-6-7;1-3(5)2-4/h8-11H,3-7H2,1-2H3;2-6H,1H3;3-5H,2H2,1H3 |
| InChIKey | OGJYDVAVEGUKTC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.50 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |