C31H40O4P+ — CID 175204454
benzoyloxy-[2-butyl-1-hydroxy-3-(hydroxymethyl)heptyl]-diphenylphosphanium (PubChem CID 175204454) has the molecular formula C31H40O4P+ and a molecular weight of 507.63 g/mol. Its IUPAC name is benzoyloxy-[2-butyl-1-hydroxy-3-(hydroxymethyl)heptyl]-diphenylphosphanium.
| Compound Name | benzoyloxy-[2-butyl-1-hydroxy-3-(hydroxymethyl)heptyl]-diphenylphosphanium |
|---|---|
| PubChem CID | 175204454 |
| Molecular Formula | C31H40O4P+ |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | benzoyloxy-[2-butyl-1-hydroxy-3-(hydroxymethyl)heptyl]-diphenylphosphanium |
| SMILES | CCCCC(CO)C(CCCC)C(O)[P+](OC(=O)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H40O4P/c1-3-5-16-26(24-32)29(23-6-4-2)31(34)36(27-19-12-8-13-20-27,28-21-14-9-15-22-28)35-30(33)25-17-10-7-11-18-25/h7-15,17-22,26,29,31-32,34H,3-6,16,23-24H2,1-2H3/q+1 |
| InChIKey | QEKFSEAEMPPGFO-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|